C29H25N3O5 — CID 130247474
(E)-3-(4-hydroxy-3-methoxyphenyl)-N-[[9-(4-hydroxy-3-methoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide (PubChem CID 130247474) has the molecular formula C29H25N3O5 and a molecular weight of 495.54 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[[9-(4-hydroxy-3-methoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[[9-(4-hydroxy-3-methoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 130247474 |
| Molecular Formula | C29H25N3O5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[[9-(4-hydroxy-3-methoxyphenyl)pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2cc3c4ccccc4n(-c4ccc(O)c(OC)c4)c3cn2)ccc1O |
| InChI | InChI=1S/C29H25N3O5/c1-36-27-13-18(7-10-25(27)33)8-12-29(35)31-16-19-14-22-21-5-3-4-6-23(21)32(24(22)17-30-19)20-9-11-26(34)28(15-20)37-2/h3-15,17,33-34H,16H2,1-2H3,(H,31,35)/b12-8+ |
| InChIKey | CWVBREXIHSQLIX-XYOKQWHBSA-N |
| XLogP | 4.94 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|