C28H20F3N3O4 — CID 130247832
(E)-N-[[9-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide (PubChem CID 130247832) has the molecular formula C28H20F3N3O4 and a molecular weight of 519.48 g/mol. Its IUPAC name is (E)-N-[[9-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[9-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 130247832 |
| Molecular Formula | C28H20F3N3O4 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (E)-N-[[9-[4-(trifluoromethyl)phenyl]pyrido[3,4-b]indol-3-yl]methyl]-3-(3,4,5-trihydroxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(O)c(O)c(O)c1)NCc1cc2c3ccccc3n(-c3ccc(C(F)(F)F)cc3)c2cn1 |
| InChI | InChI=1S/C28H20F3N3O4/c29-28(30,31)17-6-8-19(9-7-17)34-22-4-2-1-3-20(22)21-13-18(32-15-23(21)34)14-33-26(37)10-5-16-11-24(35)27(38)25(36)12-16/h1-13,15,35-36,38H,14H2,(H,33,37)/b10-5+ |
| InChIKey | XZUBTCJVPMGKAO-BJMVGYQFSA-N |
| XLogP | 5.64 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|