C19H15F3N2O — CID 168830334
N-[[1-[4-(trifluoromethyl)phenyl]indol-2-yl]methyl]prop-2-enamide (PubChem CID 168830334) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is N-[[1-[4-(trifluoromethyl)phenyl]indol-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[1-[4-(trifluoromethyl)phenyl]indol-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168830334 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[[1-[4-(trifluoromethyl)phenyl]indol-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc2ccccc2n1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H15F3N2O/c1-2-18(25)23-12-16-11-13-5-3-4-6-17(13)24(16)15-9-7-14(8-10-15)19(20,21)22/h2-11H,1,12H2,(H,23,25) |
| InChIKey | NKIOZWMZFVFDTP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|