C20H20F3N3O3S — CID 172543276
N-[[1-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]-2,3-dihydroquinoxalin-2-yl]methyl]prop-2-enamide (PubChem CID 172543276) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[[1-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]-2,3-dihydroquinoxalin-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[1-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]-2,3-dihydroquinoxalin-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 172543276 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[[1-methylsulfonyl-4-[4-(trifluoromethyl)phenyl]-2,3-dihydroquinoxalin-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC1CN(c2ccc(C(F)(F)F)cc2)c2ccccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C20H20F3N3O3S/c1-3-19(27)24-12-16-13-25(15-10-8-14(9-11-15)20(21,22)23)17-6-4-5-7-18(17)26(16)30(2,28)29/h3-11,16H,1,12-13H2,2H3,(H,24,27) |
| InChIKey | IHIFRCNBAILCHX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|