C19H20F4N4O+ — CID 168966022
CID 168966022 (PubChem CID 168966022) has the molecular formula C19H20F4N4O+ and a molecular weight of 396.39 g/mol.
| Compound Name | CID 168966022 |
|---|---|
| PubChem CID | 168966022 |
| Molecular Formula | C19H20F4N4O+ |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | — |
| SMILES | C=CC(=O)NCC1CC2=C([CH]N=[N+]2C(C)F)N(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H19F4N4O/c1-3-18(28)24-9-13-8-16-17(10-25-27(16)12(2)20)26(11-13)15-6-4-14(5-7-15)19(21,22)23/h3-7,10,12-13H,1,8-9,11H2,2H3/p+1 |
| InChIKey | XAQQAKHXPYGBBM-UHFFFAOYSA-O |
| XLogP | 4.00 |
| TPSA | 47.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|