C20H19F3N2O — CID 170679886
N-[[(3S)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]methyl]prop-2-enamide (PubChem CID 170679886) has the molecular formula C20H19F3N2O and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[[(3S)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]methyl]prop-2-enamide.
| Compound Name | N-[[(3S)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 170679886 |
| Molecular Formula | C20H19F3N2O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[[(3S)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NC[C@@H]1Cc2ccccc2N(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C20H19F3N2O/c1-2-19(26)24-12-14-11-15-5-3-4-6-18(15)25(13-14)17-9-7-16(8-10-17)20(21,22)23/h2-10,14H,1,11-13H2,(H,24,26)/t14-/m0/s1 |
| InChIKey | GASWGFKBGXIXJZ-AWEZNQCLSA-N |
| XLogP | 4.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|