C19H17F3N2O3S — CID 163235834
N-[1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide (PubChem CID 163235834) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is N-[1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163235834 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | N-[1-[4-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1Cc2ccccc2N(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C19H17F3N2O3S/c1-2-18(25)23-15-11-13-5-3-4-6-17(13)24(12-15)28(26,27)16-9-7-14(8-10-16)19(20,21)22/h2-10,15H,1,11-12H2,(H,23,25) |
| InChIKey | TXWKAMAOJRQFEX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|