C26H22F4N2O — CID 163235976
N-[5-[(3-fluorophenyl)methyl]-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide (PubChem CID 163235976) has the molecular formula C26H22F4N2O and a molecular weight of 454.47 g/mol. Its IUPAC name is N-[5-[(3-fluorophenyl)methyl]-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide.
| Compound Name | N-[5-[(3-fluorophenyl)methyl]-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163235976 |
| Molecular Formula | C26H22F4N2O |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-[5-[(3-fluorophenyl)methyl]-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1Cc2c(Cc3cccc(F)c3)cccc2N(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C26H22F4N2O/c1-2-25(33)31-21-15-23-18(13-17-5-3-7-20(27)14-17)6-4-8-24(23)32(16-21)22-11-9-19(10-12-22)26(28,29)30/h2-12,14,21H,1,13,15-16H2,(H,31,33) |
| InChIKey | JDAQXMDWMQSVJK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|