C21H19F3N2O3 — CID 175994010
2-[(3R)-3-(prop-2-enoylamino)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-5-yl]acetic acid (PubChem CID 175994010) has the molecular formula C21H19F3N2O3 and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[(3R)-3-(prop-2-enoylamino)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-5-yl]acetic acid.
| Compound Name | 2-[(3R)-3-(prop-2-enoylamino)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-5-yl]acetic acid |
|---|---|
| PubChem CID | 175994010 |
| Molecular Formula | C21H19F3N2O3 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(3R)-3-(prop-2-enoylamino)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-5-yl]acetic acid |
| SMILES | C=CC(=O)N[C@@H]1Cc2c(CC(=O)O)cccc2N(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H19F3N2O3/c1-2-19(27)25-15-11-17-13(10-20(28)29)4-3-5-18(17)26(12-15)16-8-6-14(7-9-16)21(22,23)24/h2-9,15H,1,10-12H2,(H,25,27)(H,28,29)/t15-/m1/s1 |
| InChIKey | ZJTYAFWDCXCMJE-OAHLLOKOSA-N |
| XLogP | 3.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|