C18H17ClN2O — CID 163235831
N-[1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide (PubChem CID 163235831) has the molecular formula C18H17ClN2O and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide.
| Compound Name | N-[1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163235831 |
| Molecular Formula | C18H17ClN2O |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1Cc2ccccc2N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17ClN2O/c1-2-18(22)20-15-11-13-5-3-4-6-17(13)21(12-15)16-9-7-14(19)8-10-16/h2-10,15H,1,11-12H2,(H,20,22) |
| InChIKey | DUJTZNHYYWXEIO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|