C16H15ClN2O2 — CID 175464845
[1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl] carbamate (PubChem CID 175464845) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl] carbamate.
| Compound Name | [1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl] carbamate |
|---|---|
| PubChem CID | 175464845 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | [1-(4-chlorophenyl)-3,4-dihydro-2H-quinolin-3-yl] carbamate |
| SMILES | NC(=O)OC1Cc2ccccc2N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H15ClN2O2/c17-12-5-7-13(8-6-12)19-10-14(21-16(18)20)9-11-3-1-2-4-15(11)19/h1-8,14H,9-10H2,(H2,18,20) |
| InChIKey | VKZJOUVFDURXIE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |