C17H17FN2S — CID 115368336
2-fluoro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide (PubChem CID 115368336) has the molecular formula C17H17FN2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-fluoro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide.
| Compound Name | 2-fluoro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 115368336 |
| Molecular Formula | C17H17FN2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-fluoro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
| SMILES | CC1Cc2ccccc2N(c2ccc(C(N)=S)c(F)c2)C1 |
| InChI | InChI=1S/C17H17FN2S/c1-11-8-12-4-2-3-5-16(12)20(10-11)13-6-7-14(17(19)21)15(18)9-13/h2-7,9,11H,8,10H2,1H3,(H2,19,21) |
| InChIKey | UBSXRARTSRXZLZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|