C16H15FN2S — CID 115367814
4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-fluorobenzenecarbothioamide (PubChem CID 115367814) has the molecular formula C16H15FN2S and a molecular weight of 286.38 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-fluorobenzenecarbothioamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 115367814 |
| Molecular Formula | C16H15FN2S |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCc3ccccc3C2)cc1F |
| InChI | InChI=1S/C16H15FN2S/c17-15-9-13(5-6-14(15)16(18)20)19-8-7-11-3-1-2-4-12(11)10-19/h1-6,9H,7-8,10H2,(H2,18,20) |
| InChIKey | QHKOFPPZJMTURQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|