C11H13FN2OS2 — CID 113295859
2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarbothioamide (PubChem CID 113295859) has the molecular formula C11H13FN2OS2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarbothioamide.
| Compound Name | 2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 113295859 |
| Molecular Formula | C11H13FN2OS2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-fluoro-4-(1-oxo-1,4-thiazinan-4-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCS(=O)CC2)cc1F |
| InChI | InChI=1S/C11H13FN2OS2/c12-10-7-8(1-2-9(10)11(13)16)14-3-5-17(15)6-4-14/h1-2,7H,3-6H2,(H2,13,16) |
| InChIKey | QBQBEJSLWLAYGB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|