C16H16Cl2N2 — CID 106890411
3,5-dichloro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline (PubChem CID 106890411) has the molecular formula C16H16Cl2N2 and a molecular weight of 307.22 g/mol. Its IUPAC name is 3,5-dichloro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline.
| Compound Name | 3,5-dichloro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline |
|---|---|
| PubChem CID | 106890411 |
| Molecular Formula | C16H16Cl2N2 |
| Molecular Weight | 307.22 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3,5-dichloro-4-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline |
| SMILES | CC1Cc2ccccc2N(c2c(Cl)cc(N)cc2Cl)C1 |
| InChI | InChI=1S/C16H16Cl2N2/c1-10-6-11-4-2-3-5-15(11)20(9-10)16-13(17)7-12(19)8-14(16)18/h2-5,7-8,10H,6,9,19H2,1H3 |
| InChIKey | ILCUQGVEZBJDAO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.22 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|