C17H18N2O2 — CID 63423175
5-amino-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid (PubChem CID 63423175) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 5-amino-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid.
| Compound Name | 5-amino-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 63423175 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-amino-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)benzoic acid |
| SMILES | CC1Cc2ccccc2N(c2ccc(N)cc2C(=O)O)C1 |
| InChI | InChI=1S/C17H18N2O2/c1-11-8-12-4-2-3-5-15(12)19(10-11)16-7-6-13(18)9-14(16)17(20)21/h2-7,9,11H,8,10,18H2,1H3,(H,20,21) |
| InChIKey | PFRGGUQGVDMCGK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|