C17H20N2 — CID 115550530
3-methyl-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline (PubChem CID 115550530) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 3-methyl-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline.
| Compound Name | 3-methyl-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline |
|---|---|
| PubChem CID | 115550530 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-methyl-2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)aniline |
| SMILES | Cc1cccc(N)c1N1CC(C)Cc2ccccc21 |
| InChI | InChI=1S/C17H20N2/c1-12-10-14-7-3-4-9-16(14)19(11-12)17-13(2)6-5-8-15(17)18/h3-9,12H,10-11,18H2,1-2H3 |
| InChIKey | IJQHPCBFVDDIRL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|