C15H19N5 — CID 80909836
[2-methyl-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80909836) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is [2-methyl-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [2-methyl-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80909836 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [2-methyl-6-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)pyrimidin-4-yl]hydrazine |
| SMILES | Cc1nc(NN)cc(N2CC(C)Cc3ccccc32)n1 |
| InChI | InChI=1S/C15H19N5/c1-10-7-12-5-3-4-6-13(12)20(9-10)15-8-14(19-16)17-11(2)18-15/h3-6,8,10H,7,9,16H2,1-2H3,(H,17,18,19) |
| InChIKey | KEXIBDLWNUKPBO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|