About 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide
2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide (PubChem CID 63543703) has the molecular formula C18H20N2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide |
| PubChem CID | 63543703 |
| Molecular Formula | C18H20N2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide |
| SMILES | CC1Cc2ccccc2N(Cc2ccccc2C(N)=S)C1 |
| InChI | InChI=1S/C18H20N2S/c1-13-10-14-6-3-5-9-17(14)20(11-13)12-15-7-2-4-8-16(15)18(19)21/h2-9,13H,10-12H2,1H3,(H2,19,21) |
| InChIKey | BCCCMUUPMSTHLY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide?
The IUPAC name of 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide (CID 63543703) is 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide.
What is the SMILES notation for 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide?
The canonical SMILES for 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide is CC1Cc2ccccc2N(Cc2ccccc2C(N)=S)C1.
What is the InChIKey of 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide?
The InChIKey is BCCCMUUPMSTHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2S/c1-13-10-14-6-3-5-9-17(14)20(11-13)12-15-7-2-4-8-16(15)18(19)21/h2-9,13H,10-12H2,1H3,(H2,19,21).
What are the key properties of 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide?
2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide has a molecular weight of 296.44 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]benzenecarbothioamide is sourced from PubChem (CID 63543703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).