About 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide
4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide (PubChem CID 63883465) has the molecular formula C17H19N3S
and a molecular weight of 297.43 g/mol. Its IUPAC name is 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide |
| PubChem CID | 63883465 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide |
| SMILES | CC1Cc2ccccc2N(Cc2ccnc(C(N)=S)c2)C1 |
| InChI | InChI=1S/C17H19N3S/c1-12-8-14-4-2-3-5-16(14)20(10-12)11-13-6-7-19-15(9-13)17(18)21/h2-7,9,12H,8,10-11H2,1H3,(H2,18,21) |
| InChIKey | OXKFXYSTGFLRIT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide?
The IUPAC name of 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide (CID 63883465) is 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide.
What is the SMILES notation for 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide?
The canonical SMILES for 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide is CC1Cc2ccccc2N(Cc2ccnc(C(N)=S)c2)C1.
What is the InChIKey of 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide?
The InChIKey is OXKFXYSTGFLRIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3S/c1-12-8-14-4-2-3-5-16(14)20(10-12)11-13-6-7-19-15(9-13)17(18)21/h2-7,9,12H,8,10-11H2,1H3,(H2,18,21).
What are the key properties of 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide?
4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide has a molecular weight of 297.43 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3-methyl-3,4-dihydro-2H-quinolin-1-yl)methyl]pyridine-2-carbothioamide is sourced from PubChem (CID 63883465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).