C12H14N2 — CID 15304197
2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)acetonitrile (PubChem CID 15304197) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)acetonitrile.
| Compound Name | 2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)acetonitrile |
|---|---|
| PubChem CID | 15304197 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)acetonitrile |
| SMILES | CC1Cc2ccccc2N(CC#N)C1 |
| InChI | InChI=1S/C12H14N2/c1-10-8-11-4-2-3-5-12(11)14(9-10)7-6-13/h2-5,10H,7-9H2,1H3 |
| InChIKey | QIHOFMTWBQIIAL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|