C14H20BrN — CID 63447089
1-(4-bromobutyl)-3-methyl-3,4-dihydro-2H-quinoline (PubChem CID 63447089) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 1-(4-bromobutyl)-3-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-bromobutyl)-3-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 63447089 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(4-bromobutyl)-3-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1Cc2ccccc2N(CCCCBr)C1 |
| InChI | InChI=1S/C14H20BrN/c1-12-10-13-6-2-3-7-14(13)16(11-12)9-5-4-8-15/h2-3,6-7,12H,4-5,8-11H2,1H3 |
| InChIKey | AHLYWHCQOGUFKI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|