C24H26F3N3O2 — CID 163235786
N-[5-(morpholin-4-ylmethyl)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide (PubChem CID 163235786) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[5-(morpholin-4-ylmethyl)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide.
| Compound Name | N-[5-(morpholin-4-ylmethyl)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 163235786 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[5-(morpholin-4-ylmethyl)-1-[4-(trifluoromethyl)phenyl]-3,4-dihydro-2H-quinolin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1Cc2c(CN3CCOCC3)cccc2N(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-2-23(31)28-19-14-21-17(15-29-10-12-32-13-11-29)4-3-5-22(21)30(16-19)20-8-6-18(7-9-20)24(25,26)27/h2-9,19H,1,10-16H2,(H,28,31) |
| InChIKey | AJJRQDVCORGWBD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|