C31H29N3O4 — CID 130269600
3-[(1E)-3-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methylamino]buta-1,3-dienyl]phenol (PubChem CID 130269600) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is 3-[(1E)-3-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methylamino]buta-1,3-dienyl]phenol.
| Compound Name | 3-[(1E)-3-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methylamino]buta-1,3-dienyl]phenol |
|---|---|
| PubChem CID | 130269600 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 3-[(1E)-3-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methylamino]buta-1,3-dienyl]phenol |
| SMILES | C=C(/C=C/c1cccc(O)c1)NCc1cc2c([nH]c3ccccc32)c(-c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C31H29N3O4/c1-19(12-13-20-8-7-9-23(35)14-20)32-18-22-17-25-24-10-5-6-11-26(24)34-30(25)29(33-22)21-15-27(36-2)31(38-4)28(16-21)37-3/h5-17,32,34-35H,1,18H2,2-4H3/b13-12+ |
| InChIKey | KRIHJHSGDMPMPZ-OUKQBFOZSA-N |
| XLogP | 6.43 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|