C27H22N2O4S — CID 155545497
(E)-1-thiophen-2-yl-3-[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one (PubChem CID 155545497) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is (E)-1-thiophen-2-yl-3-[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-thiophen-2-yl-3-[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155545497 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | (E)-1-thiophen-2-yl-3-[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]prop-2-en-1-one |
| SMILES | COc1cc(-c2nc(/C=C/C(=O)c3cccs3)cc3c2[nH]c2ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C27H22N2O4S/c1-31-22-13-16(14-23(32-2)27(22)33-3)25-26-19(18-7-4-5-8-20(18)29-26)15-17(28-25)10-11-21(30)24-9-6-12-34-24/h4-15,29H,1-3H3/b11-10+ |
| InChIKey | HVHDIEJVMLWVSP-ZHACJKMWSA-N |
| XLogP | 6.37 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|