C40H39N3O8 — CID 155552426
(E)-3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide (PubChem CID 155552426) has the molecular formula C40H39N3O8 and a molecular weight of 689.77 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 155552426 |
| Molecular Formula | C40H39N3O8 |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 689.27 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)-N-[[1-(3,4,5-trimethoxyphenyl)-9H-pyrido[3,4-b]indol-3-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C(/C(=O)NCc2cc3c([nH]c4ccccc43)c(-c3cc(OC)c(OC)c(OC)c3)n2)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C40H39N3O8/c1-45-27-14-12-23(13-15-27)16-29(24-17-32(46-2)38(50-6)33(18-24)47-3)40(44)41-22-26-21-30-28-10-8-9-11-31(28)43-37(30)36(42-26)25-19-34(48-4)39(51-7)35(20-25)49-5/h8-21,43H,22H2,1-7H3,(H,41,44)/b29-16+ |
| InChIKey | KHJINFOJSBEIOQ-MUFRIFMGSA-N |
| XLogP | 7.30 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|