C26H27NO7 — CID 175348751
1-(3,4,5-trimethoxyphenyl)-3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]prop-2-en-1-one (PubChem CID 175348751) has the molecular formula C26H27NO7 and a molecular weight of 465.50 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]prop-2-en-1-one.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175348751 |
| Molecular Formula | C26H27NO7 |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-3-[6-(3,4,5-trimethoxyphenyl)-2-pyridinyl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)C=Cc2cccc(-c3cc(OC)c(OC)c(OC)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H27NO7/c1-29-21-12-16(13-22(30-2)25(21)33-5)19-9-7-8-18(27-19)10-11-20(28)17-14-23(31-3)26(34-6)24(15-17)32-4/h7-15H,1-6H3 |
| InChIKey | UTRXRFWOZGDLEJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|