C29H30O9 — CID 155806632
(E)-3-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 155806632) has the molecular formula C29H30O9 and a molecular weight of 522.55 g/mol. Its IUPAC name is (E)-3-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 155806632 |
| Molecular Formula | C29H30O9 |
| Molecular Weight | 522.55 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (E)-3-[2-methoxy-5-(3,4,5-trimethoxybenzoyl)phenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)c2cc(OC)c(OC)c(OC)c2)cc1/C=C/C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C29H30O9/c1-32-22-11-9-18(27(31)20-15-25(35-4)29(38-7)26(16-20)36-5)12-17(22)8-10-21(30)19-13-23(33-2)28(37-6)24(14-19)34-3/h8-16H,1-7H3/b10-8+ |
| InChIKey | DMHBWIHTQRKMPZ-CSKARUKUSA-N |
| XLogP | 4.87 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|