C27H24O5S — CID 22025550
(E)-3-[5-(1-benzothiophen-2-yl)-2-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 22025550) has the molecular formula C27H24O5S and a molecular weight of 460.55 g/mol. Its IUPAC name is (E)-3-[5-(1-benzothiophen-2-yl)-2-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-(1-benzothiophen-2-yl)-2-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 22025550 |
| Molecular Formula | C27H24O5S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (E)-3-[5-(1-benzothiophen-2-yl)-2-methoxyphenyl]-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2cc3ccccc3s2)cc1/C=C/C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C27H24O5S/c1-29-22-12-10-19(26-16-18-7-5-6-8-25(18)33-26)13-17(22)9-11-21(28)20-14-23(30-2)27(32-4)24(15-20)31-3/h5-16H,1-4H3/b11-9+ |
| InChIKey | WBGOWDBYMVBLRG-PKNBQFBNSA-N |
| XLogP | 6.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|