C26H19O5S- — CID 21041600
2-[(E)-3-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzoate (PubChem CID 21041600) has the molecular formula C26H19O5S- and a molecular weight of 443.50 g/mol. Its IUPAC name is 2-[(E)-3-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzoate.
| Compound Name | 2-[(E)-3-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzoate |
|---|---|
| PubChem CID | 21041600 |
| Molecular Formula | C26H19O5S- |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | 2-[(E)-3-[5-(1-benzothiophen-2-yl)-2,4-dimethoxyphenyl]prop-2-enoyl]benzoate |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3s2)cc1/C=C/C(=O)c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C26H20O5S/c1-30-22-15-23(31-2)20(25-14-17-7-3-6-10-24(17)32-25)13-16(22)11-12-21(27)18-8-4-5-9-19(18)26(28)29/h3-15H,1-2H3,(H,28,29)/p-1/b12-11+ |
| InChIKey | ALTGDKDPUVAGOP-VAWYXSNFSA-M |
| XLogP | 4.85 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|