C27H23NO5 — CID 10173610
4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]benzoic acid (PubChem CID 10173610) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10173610 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[(E)-3-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OC)c(-c2cc3ccccc3n2C)cc1/C=C/C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-28-22-7-5-4-6-19(22)15-23(28)21-14-20(25(32-2)16-26(21)33-3)12-13-24(29)17-8-10-18(11-9-17)27(30)31/h4-16H,1-3H3,(H,30,31)/b13-12+ |
| InChIKey | JSISGUJQAHQSIZ-OUKQBFOZSA-N |
| XLogP | 5.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|