C25H22O5S — CID 21041615
4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid (PubChem CID 21041615) has the molecular formula C25H22O5S and a molecular weight of 434.51 g/mol. Its IUPAC name is 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 21041615 |
| Molecular Formula | C25H22O5S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OCC2CC2)c(/C=C/C(=O)c2ccc(C(=O)O)cc2)cc1-c1cccs1 |
| InChI | InChI=1S/C25H22O5S/c1-29-23-14-22(30-15-16-4-5-16)19(13-20(23)24-3-2-12-31-24)10-11-21(26)17-6-8-18(9-7-17)25(27)28/h2-3,6-14,16H,4-5,15H2,1H3,(H,27,28)/b11-10+ |
| InChIKey | IWNMEAGCYCJUES-ZHACJKMWSA-N |
| XLogP | 5.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|