C24H22O6S — CID 72523989
5-[3-(3,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]-2,3-dimethoxybenzaldehyde (PubChem CID 72523989) has the molecular formula C24H22O6S and a molecular weight of 438.50 g/mol. Its IUPAC name is 5-[3-(3,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]-2,3-dimethoxybenzaldehyde.
| Compound Name | 5-[3-(3,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]-2,3-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 72523989 |
| Molecular Formula | C24H22O6S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 5-[3-(3,4-dimethoxy-5-thiophen-2-ylphenyl)prop-2-enoyl]-2,3-dimethoxybenzaldehyde |
| SMILES | COc1cc(C(=O)C=Cc2cc(OC)c(OC)c(-c3cccs3)c2)cc(C=O)c1OC |
| InChI | InChI=1S/C24H22O6S/c1-27-20-11-15(10-18(24(20)30-4)22-6-5-9-31-22)7-8-19(26)16-12-17(14-25)23(29-3)21(13-16)28-2/h5-14H,1-4H3 |
| InChIKey | UUUPPHLJCLSLKJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|