C22H24O4S — CID 143844967
2-(2-methylphenyl)thiophene;1-(3,4,5-trimethoxyphenyl)ethanone (PubChem CID 143844967) has the molecular formula C22H24O4S and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-(2-methylphenyl)thiophene;1-(3,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 2-(2-methylphenyl)thiophene;1-(3,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 143844967 |
| Molecular Formula | C22H24O4S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(2-methylphenyl)thiophene;1-(3,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(C(C)=O)cc(OC)c1OC.Cc1ccccc1-c1cccs1 |
| InChI | InChI=1S/C11H14O4.C11H10S/c1-7(12)8-5-9(13-2)11(15-4)10(6-8)14-3;1-9-5-2-3-6-10(9)11-7-4-8-12-11/h5-6H,1-4H3;2-8H,1H3 |
| InChIKey | UVOXGJSIRRKDKN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |