C23H19NO6S — CID 10127312
4-[(E)-3-[2-(2-amino-2-oxoethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid (PubChem CID 10127312) has the molecular formula C23H19NO6S and a molecular weight of 437.47 g/mol. Its IUPAC name is 4-[(E)-3-[2-(2-amino-2-oxoethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[2-(2-amino-2-oxoethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10127312 |
| Molecular Formula | C23H19NO6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 4-[(E)-3-[2-(2-amino-2-oxoethoxy)-4-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OCC(N)=O)c(/C=C/C(=O)c2ccc(C(=O)O)cc2)cc1-c1cccs1 |
| InChI | InChI=1S/C23H19NO6S/c1-29-20-12-19(30-13-22(24)26)16(11-17(20)21-3-2-10-31-21)8-9-18(25)14-4-6-15(7-5-14)23(27)28/h2-12H,13H2,1H3,(H2,24,26)(H,27,28)/b9-8+ |
| InChIKey | VOBVIFWLLKQYMS-CMDGGOBGSA-N |
| XLogP | 3.88 |
| TPSA | 115.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|