C21H21O5P — CID 142259424
4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-phosphanylphenyl]prop-2-enoyl]benzoic acid (PubChem CID 142259424) has the molecular formula C21H21O5P and a molecular weight of 384.37 g/mol. Its IUPAC name is 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-phosphanylphenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-phosphanylphenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 142259424 |
| Molecular Formula | C21H21O5P |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 4-[(E)-3-[2-(cyclopropylmethoxy)-4-methoxy-5-phosphanylphenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OCC2CC2)c(/C=C/C(=O)c2ccc(C(=O)O)cc2)cc1P |
| InChI | InChI=1S/C21H21O5P/c1-25-19-11-18(26-12-13-2-3-13)16(10-20(19)27)8-9-17(22)14-4-6-15(7-5-14)21(23)24/h4-11,13H,2-3,12,27H2,1H3,(H,23,24)/b9-8+ |
| InChIKey | NMTAYOYQQBTXAI-CMDGGOBGSA-N |
| XLogP | 3.58 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|