C22H18O5S — CID 18449301
4-[3-(2,4-dimethoxy-5-thiophen-2-ylphenyl)-1-hydroxyprop-2-ynyl]benzoic acid (PubChem CID 18449301) has the molecular formula C22H18O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 4-[3-(2,4-dimethoxy-5-thiophen-2-ylphenyl)-1-hydroxyprop-2-ynyl]benzoic acid.
| Compound Name | 4-[3-(2,4-dimethoxy-5-thiophen-2-ylphenyl)-1-hydroxyprop-2-ynyl]benzoic acid |
|---|---|
| PubChem CID | 18449301 |
| Molecular Formula | C22H18O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4-[3-(2,4-dimethoxy-5-thiophen-2-ylphenyl)-1-hydroxyprop-2-ynyl]benzoic acid |
| SMILES | COc1cc(OC)c(-c2cccs2)cc1C#CC(O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H18O5S/c1-26-19-13-20(27-2)17(21-4-3-11-28-21)12-16(19)9-10-18(23)14-5-7-15(8-6-14)22(24)25/h3-8,11-13,18,23H,1-2H3,(H,24,25) |
| InChIKey | KYNCJBCKAHFUEN-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|