C16H12O3 — CID 19705966
4-(1-hydroxy-3-phenylprop-2-ynyl)benzoic acid (PubChem CID 19705966) has the molecular formula C16H12O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-(1-hydroxy-3-phenylprop-2-ynyl)benzoic acid.
| Compound Name | 4-(1-hydroxy-3-phenylprop-2-ynyl)benzoic acid |
|---|---|
| PubChem CID | 19705966 |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 4-(1-hydroxy-3-phenylprop-2-ynyl)benzoic acid |
| SMILES | O=C(O)c1ccc(C(O)C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H12O3/c17-15(11-6-12-4-2-1-3-5-12)13-7-9-14(10-8-13)16(18)19/h1-5,7-10,15,17H,(H,18,19) |
| InChIKey | NVJMDWMKGXRNPW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|