C22H18O2 — CID 134843042
3-(1,5-diphenylpenta-1,4-diyn-3-yl)pentane-2,4-dione (PubChem CID 134843042) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-(1,5-diphenylpenta-1,4-diyn-3-yl)pentane-2,4-dione.
| Compound Name | 3-(1,5-diphenylpenta-1,4-diyn-3-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 134843042 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-(1,5-diphenylpenta-1,4-diyn-3-yl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)C(C#Cc1ccccc1)C#Cc1ccccc1 |
| InChI | InChI=1S/C22H18O2/c1-17(23)22(18(2)24)21(15-13-19-9-5-3-6-10-19)16-14-20-11-7-4-8-12-20/h3-12,21-22H,1-2H3 |
| InChIKey | AFBAHTBNXUPUEB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|