C18H16O2S — CID 102312744
3-[(1R)-1-phenyl-3-thiophen-3-ylprop-2-ynyl]pentane-2,4-dione (PubChem CID 102312744) has the molecular formula C18H16O2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-[(1R)-1-phenyl-3-thiophen-3-ylprop-2-ynyl]pentane-2,4-dione.
| Compound Name | 3-[(1R)-1-phenyl-3-thiophen-3-ylprop-2-ynyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 102312744 |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 3-[(1R)-1-phenyl-3-thiophen-3-ylprop-2-ynyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H](C#Cc1ccsc1)c1ccccc1 |
| InChI | InChI=1S/C18H16O2S/c1-13(19)18(14(2)20)17(16-6-4-3-5-7-16)9-8-15-10-11-21-12-15/h3-7,10-12,17-18H,1-2H3/t17-/m0/s1 |
| InChIKey | NZVDJEYQKOHAAE-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|