C15H9NOS — CID 87072517
2-(4-thiophen-3-ylbuta-1,3-diynyl)benzamide (PubChem CID 87072517) has the molecular formula C15H9NOS and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-(4-thiophen-3-ylbuta-1,3-diynyl)benzamide.
| Compound Name | 2-(4-thiophen-3-ylbuta-1,3-diynyl)benzamide |
|---|---|
| PubChem CID | 87072517 |
| Molecular Formula | C15H9NOS |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(4-thiophen-3-ylbuta-1,3-diynyl)benzamide |
| SMILES | NC(=O)c1ccccc1C#CC#Cc1ccsc1 |
| InChI | InChI=1S/C15H9NOS/c16-15(17)14-8-4-3-7-13(14)6-2-1-5-12-9-10-18-11-12/h3-4,7-11H,(H2,16,17) |
| InChIKey | GCNBUSADQNRZGE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|