C12H10N2O2S — CID 174964075
3-thiophen-3-ylbenzene-1,2-dicarboxamide (PubChem CID 174964075) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-thiophen-3-ylbenzene-1,2-dicarboxamide.
| Compound Name | 3-thiophen-3-ylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174964075 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-thiophen-3-ylbenzene-1,2-dicarboxamide |
| SMILES | NC(=O)c1cccc(-c2ccsc2)c1C(N)=O |
| InChI | InChI=1S/C12H10N2O2S/c13-11(15)9-3-1-2-8(10(9)12(14)16)7-4-5-17-6-7/h1-6H,(H2,13,15)(H2,14,16) |
| InChIKey | BFJKUWPVJWUYBT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |