About 4-thiophen-3-yl-2,3-dihydroisoindol-1-one
4-thiophen-3-yl-2,3-dihydroisoindol-1-one (PubChem CID 175996469) has the molecular formula C12H9NOS
and a molecular weight of 215.28 g/mol. Its IUPAC name is 4-thiophen-3-yl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 4-thiophen-3-yl-2,3-dihydroisoindol-1-one |
| PubChem CID | 175996469 |
| Molecular Formula | C12H9NOS |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-thiophen-3-yl-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2c1cccc2-c1ccsc1 |
| InChI | InChI=1S/C12H9NOS/c14-12-10-3-1-2-9(11(10)6-13-12)8-4-5-15-7-8/h1-5,7H,6H2,(H,13,14) |
| InChIKey | DCZXAIAJDBFBGU-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-thiophen-3-yl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-3-yl-2,3-dihydroisoindol-1-one?
The IUPAC name of 4-thiophen-3-yl-2,3-dihydroisoindol-1-one (CID 175996469) is 4-thiophen-3-yl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 4-thiophen-3-yl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 4-thiophen-3-yl-2,3-dihydroisoindol-1-one is O=C1NCc2c1cccc2-c1ccsc1.
What is the InChIKey of 4-thiophen-3-yl-2,3-dihydroisoindol-1-one?
The InChIKey is DCZXAIAJDBFBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NOS/c14-12-10-3-1-2-9(11(10)6-13-12)8-4-5-15-7-8/h1-5,7H,6H2,(H,13,14).
What are the key properties of 4-thiophen-3-yl-2,3-dihydroisoindol-1-one?
4-thiophen-3-yl-2,3-dihydroisoindol-1-one has a molecular weight of 215.28 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-3-yl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 175996469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).