C20H17ClO2 — CID 102312739
3-[(1R)-1-(4-chlorophenyl)-3-phenylprop-2-ynyl]pentane-2,4-dione (PubChem CID 102312739) has the molecular formula C20H17ClO2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-[(1R)-1-(4-chlorophenyl)-3-phenylprop-2-ynyl]pentane-2,4-dione.
| Compound Name | 3-[(1R)-1-(4-chlorophenyl)-3-phenylprop-2-ynyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 102312739 |
| Molecular Formula | C20H17ClO2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | 3-[(1R)-1-(4-chlorophenyl)-3-phenylprop-2-ynyl]pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)[C@@H](C#Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO2/c1-14(22)20(15(2)23)19(17-9-11-18(21)12-10-17)13-8-16-6-4-3-5-7-16/h3-7,9-12,19-20H,1-2H3/t19-/m0/s1 |
| InChIKey | ZWZUUZCFNSGMSZ-IBGZPJMESA-N |
| XLogP | 4.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|