C23H17ClN2 — CID 11428266
3-(4-chlorophenyl)-2,4-diphenylpentanedinitrile (PubChem CID 11428266) has the molecular formula C23H17ClN2 and a molecular weight of 356.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2,4-diphenylpentanedinitrile.
| Compound Name | 3-(4-chlorophenyl)-2,4-diphenylpentanedinitrile |
|---|---|
| PubChem CID | 11428266 |
| Molecular Formula | C23H17ClN2 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-(4-chlorophenyl)-2,4-diphenylpentanedinitrile |
| SMILES | N#CC(c1ccccc1)C(c1ccc(Cl)cc1)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2/c24-20-13-11-19(12-14-20)23(21(15-25)17-7-3-1-4-8-17)22(16-26)18-9-5-2-6-10-18/h1-14,21-23H |
| InChIKey | MEGIWMHINPYFIY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |