C16H12N2 — CID 714999
(2S,3R)-2,3-diphenylbutanedinitrile (PubChem CID 714999) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is (2S,3R)-2,3-diphenylbutanedinitrile.
| Compound Name | (2S,3R)-2,3-diphenylbutanedinitrile |
|---|---|
| PubChem CID | 714999 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (2S,3R)-2,3-diphenylbutanedinitrile |
| SMILES | N#C[C@H](c1ccccc1)[C@@H](C#N)c1ccccc1 |
| InChI | InChI=1S/C16H12N2/c17-11-15(13-7-3-1-4-8-13)16(12-18)14-9-5-2-6-10-14/h1-10,15-16H/t15-,16+ |
| InChIKey | KJPHABUGXMBVHI-IYBDPMFKSA-N |
| XLogP | 3.60 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |