C17H14NO2- — CID 20501978
4-cyano-3,4-diphenylbutanoate (PubChem CID 20501978) has the molecular formula C17H14NO2- and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-cyano-3,4-diphenylbutanoate.
| Compound Name | 4-cyano-3,4-diphenylbutanoate |
|---|---|
| PubChem CID | 20501978 |
| Molecular Formula | C17H14NO2- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-cyano-3,4-diphenylbutanoate |
| SMILES | N#CC(c1ccccc1)C(CC(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C17H15NO2/c18-12-16(14-9-5-2-6-10-14)15(11-17(19)20)13-7-3-1-4-8-13/h1-10,15-16H,11H2,(H,19,20)/p-1 |
| InChIKey | FZNDGCLOBXTABS-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |