C22H21N3O — CID 90347465
(2R,3R)-5-(1,5-dimethylpyrazol-4-yl)-5-oxo-2,3-diphenylpentanenitrile (PubChem CID 90347465) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (2R,3R)-5-(1,5-dimethylpyrazol-4-yl)-5-oxo-2,3-diphenylpentanenitrile.
| Compound Name | (2R,3R)-5-(1,5-dimethylpyrazol-4-yl)-5-oxo-2,3-diphenylpentanenitrile |
|---|---|
| PubChem CID | 90347465 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2R,3R)-5-(1,5-dimethylpyrazol-4-yl)-5-oxo-2,3-diphenylpentanenitrile |
| SMILES | Cc1c(C(=O)C[C@@H](c2ccccc2)[C@@H](C#N)c2ccccc2)cnn1C |
| InChI | InChI=1S/C22H21N3O/c1-16-21(15-24-25(16)2)22(26)13-19(17-9-5-3-6-10-17)20(14-23)18-11-7-4-8-12-18/h3-12,15,19-20H,13H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | RFFHXRQBKAHOGD-PMACEKPBSA-N |
| XLogP | 4.39 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |