C23H31NO — CID 159295658
ethane;5-methoxy-2,3-diphenylhex-5-enenitrile (PubChem CID 159295658) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is ethane;5-methoxy-2,3-diphenylhex-5-enenitrile.
| Compound Name | ethane;5-methoxy-2,3-diphenylhex-5-enenitrile |
|---|---|
| PubChem CID | 159295658 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | ethane;5-methoxy-2,3-diphenylhex-5-enenitrile |
| SMILES | C=C(CC(c1ccccc1)C(C#N)c1ccccc1)OC.CC.CC |
| InChI | InChI=1S/C19H19NO.2C2H6/c1-15(21-2)13-18(16-9-5-3-6-10-16)19(14-20)17-11-7-4-8-12-17;2*1-2/h3-12,18-19H,1,13H2,2H3;2*1-2H3 |
| InChIKey | LARLIRDMQJAWDK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|