C22H28NY- — CID 160854538
2,3-diphenylhex-5-enenitrile;ethane;yttrium (PubChem CID 160854538) has the molecular formula C22H28NY- and a molecular weight of 395.38 g/mol. Its IUPAC name is 2,3-diphenylhex-5-enenitrile;ethane;yttrium.
| Compound Name | 2,3-diphenylhex-5-enenitrile;ethane;yttrium |
|---|---|
| PubChem CID | 160854538 |
| Molecular Formula | C22H28NY- |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2,3-diphenylhex-5-enenitrile;ethane;yttrium |
| SMILES | C=[C-]CC(c1ccccc1)C(C#N)c1ccccc1.CC.CC.[Y] |
| InChI | InChI=1S/C18H16N.2C2H6.Y/c1-2-9-17(15-10-5-3-6-11-15)18(14-19)16-12-7-4-8-13-16;2*1-2;/h3-8,10-13,17-18H,1,9H2;2*1-2H3;/q-1;;; |
| InChIKey | MQUVWFRBTLSPOL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|